C27H33NO2Si — CID 21477518
tert-butyl-[6-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]naphthalen-2-yl]oxy-dimethylsilane (PubChem CID 21477518) has the molecular formula C27H33NO2Si and a molecular weight of 431.65 g/mol. Its IUPAC name is tert-butyl-[6-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]naphthalen-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[6-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]naphthalen-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 21477518 |
| Molecular Formula | C27H33NO2Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | tert-butyl-[6-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]naphthalen-2-yl]oxy-dimethylsilane |
| SMILES | CC1(C)COC(c2ccc(-c3ccc4cc(O[Si](C)(C)C(C)(C)C)ccc4c3)cc2)=N1 |
| InChI | InChI=1S/C27H33NO2Si/c1-26(2,3)31(6,7)30-24-15-14-22-16-21(12-13-23(22)17-24)19-8-10-20(11-9-19)25-28-27(4,5)18-29-25/h8-17H,18H2,1-7H3 |
| InChIKey | LCBDDFQBOVUWFO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|