C21H19NO2 — CID 146025893
(4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2-phenyl-5H-1,3-oxazole (PubChem CID 146025893) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2-phenyl-5H-1,3-oxazole.
| Compound Name | (4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2-phenyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 146025893 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (4R)-4-(6-methoxynaphthalen-2-yl)-4-methyl-2-phenyl-5H-1,3-oxazole |
| SMILES | COc1ccc2cc([C@]3(C)COC(c4ccccc4)=N3)ccc2c1 |
| InChI | InChI=1S/C21H19NO2/c1-21(14-24-20(22-21)15-6-4-3-5-7-15)18-10-8-17-13-19(23-2)11-9-16(17)12-18/h3-13H,14H2,1-2H3/t21-/m0/s1 |
| InChIKey | SNPMEYWDBKWJJI-NRFANRHFSA-N |
| XLogP | 4.54 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |