C44H48BN4O4- — CID 53355034
tetrakis[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]boranuide (PubChem CID 53355034) has the molecular formula C44H48BN4O4- and a molecular weight of 707.70 g/mol. Its IUPAC name is tetrakis[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]boranuide.
| Compound Name | tetrakis[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]boranuide |
|---|---|
| PubChem CID | 53355034 |
| Molecular Formula | C44H48BN4O4- |
| Molecular Weight | 707.70 g/mol |
| Exact Mass | 707.38 |
| IUPAC Name | tetrakis[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]boranuide |
| SMILES | CC1(C)COC(c2ccc([B-](c3ccc(C4=NC(C)(C)CO4)cc3)(c3ccc(C4=NC(C)(C)CO4)cc3)c3ccc(C4=NC(C)(C)CO4)cc3)cc2)=N1 |
| InChI | InChI=1S/C44H48BN4O4/c1-41(2)25-50-37(46-41)29-9-17-33(18-10-29)45(34-19-11-30(12-20-34)38-47-42(3,4)26-51-38,35-21-13-31(14-22-35)39-48-43(5,6)27-52-39)36-23-15-32(16-24-36)40-49-44(7,8)28-53-40/h9-24H,25-28H2,1-8H3/q-1 |
| InChIKey | KEVYBZVQRMEELG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|