C14H10N2S — CID 173298269
5-(4-phenyl-3-pyridinyl)-1,3-thiazole (PubChem CID 173298269) has the molecular formula C14H10N2S and a molecular weight of 238.32 g/mol. Its IUPAC name is 5-(4-phenyl-3-pyridinyl)-1,3-thiazole.
| Compound Name | 5-(4-phenyl-3-pyridinyl)-1,3-thiazole |
|---|---|
| PubChem CID | 173298269 |
| Molecular Formula | C14H10N2S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5-(4-phenyl-3-pyridinyl)-1,3-thiazole |
| SMILES | c1ccc(-c2ccncc2-c2cncs2)cc1 |
| InChI | InChI=1S/C14H10N2S/c1-2-4-11(5-3-1)12-6-7-15-8-13(12)14-9-16-10-17-14/h1-10H |
| InChIKey | BYOHBAXNFZAQFE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |