C12H8N2OS — CID 168925780
6-(1,3-thiazol-5-yl)isoquinolin-5-ol (PubChem CID 168925780) has the molecular formula C12H8N2OS and a molecular weight of 228.28 g/mol. Its IUPAC name is 6-(1,3-thiazol-5-yl)isoquinolin-5-ol.
| Compound Name | 6-(1,3-thiazol-5-yl)isoquinolin-5-ol |
|---|---|
| PubChem CID | 168925780 |
| Molecular Formula | C12H8N2OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 6-(1,3-thiazol-5-yl)isoquinolin-5-ol |
| SMILES | Oc1c(-c2cncs2)ccc2cnccc12 |
| InChI | InChI=1S/C12H8N2OS/c15-12-9-3-4-13-5-8(9)1-2-10(12)11-6-14-7-16-11/h1-7,15H |
| InChIKey | XLKWHOGJZUAALZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |