About 3,8-phenanthroline
3,8-phenanthroline (PubChem CID 13064691) has the molecular formula C12H8N2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3,8-phenanthroline.
Molecular Properties
| Compound Name | 3,8-phenanthroline |
| PubChem CID | 13064691 |
| Molecular Formula | C12H8N2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 3,8-phenanthroline |
| SMILES | c1cc2c(ccc3cnccc32)cn1 |
| InChI | InChI=1S/C12H8N2/c1-2-10-8-14-6-4-12(10)11-3-5-13-7-9(1)11/h1-8H |
| InChIKey | SWSBZLMSDYTUAA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,8-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-phenanthroline?
The IUPAC name of 3,8-phenanthroline (CID 13064691) is 3,8-phenanthroline.
What is the SMILES notation for 3,8-phenanthroline?
The canonical SMILES for 3,8-phenanthroline is c1cc2c(ccc3cnccc32)cn1.
What is the InChIKey of 3,8-phenanthroline?
The InChIKey is SWSBZLMSDYTUAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2/c1-2-10-8-14-6-4-12(10)11-3-5-13-7-9(1)11/h1-8H.
What are the key properties of 3,8-phenanthroline?
3,8-phenanthroline has a molecular weight of 180.21 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-phenanthroline is sourced from PubChem (CID 13064691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).