C12H8N2O — CID 151551351
1H-1,8-phenanthrolin-2-one (PubChem CID 151551351) has the molecular formula C12H8N2O and a molecular weight of 196.21 g/mol. Its IUPAC name is 1H-1,8-phenanthrolin-2-one.
| Compound Name | 1H-1,8-phenanthrolin-2-one |
|---|---|
| PubChem CID | 151551351 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 1H-1,8-phenanthrolin-2-one |
| SMILES | O=c1ccc2ccc3cnccc3c2[nH]1 |
| InChI | InChI=1S/C12H8N2O/c15-11-4-3-8-1-2-9-7-13-6-5-10(9)12(8)14-11/h1-7H,(H,14,15) |
| InChIKey | QAOBXCQDODKOIQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|