About benzo[f]isoquinoline;N-butylbutan-1-amine
benzo[f]isoquinoline;N-butylbutan-1-amine (PubChem CID 69134748) has the molecular formula C21H28N2
and a molecular weight of 308.47 g/mol. Its IUPAC name is benzo[f]isoquinoline;N-butylbutan-1-amine.
Molecular Properties
| Compound Name | benzo[f]isoquinoline;N-butylbutan-1-amine |
| PubChem CID | 69134748 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | benzo[f]isoquinoline;N-butylbutan-1-amine |
| SMILES | CCCCNCCCC.c1ccc2c(c1)ccc1cnccc12 |
| InChI | InChI=1S/C13H9N.C8H19N/c1-2-4-12-10(3-1)5-6-11-9-14-8-7-13(11)12;1-3-5-7-9-8-6-4-2/h1-9H;9H,3-8H2,1-2H3 |
| InChIKey | CVYUJYYOLUSWDV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[f]isoquinoline;N-butylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[f]isoquinoline;N-butylbutan-1-amine?
The IUPAC name of benzo[f]isoquinoline;N-butylbutan-1-amine (CID 69134748) is benzo[f]isoquinoline;N-butylbutan-1-amine.
What is the SMILES notation for benzo[f]isoquinoline;N-butylbutan-1-amine?
The canonical SMILES for benzo[f]isoquinoline;N-butylbutan-1-amine is CCCCNCCCC.c1ccc2c(c1)ccc1cnccc12.
What is the InChIKey of benzo[f]isoquinoline;N-butylbutan-1-amine?
The InChIKey is CVYUJYYOLUSWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C8H19N/c1-2-4-12-10(3-1)5-6-11-9-14-8-7-13(11)12;1-3-5-7-9-8-6-4-2/h1-9H;9H,3-8H2,1-2H3.
What are the key properties of benzo[f]isoquinoline;N-butylbutan-1-amine?
benzo[f]isoquinoline;N-butylbutan-1-amine has a molecular weight of 308.47 g/mol, XLogP of 5.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[f]isoquinoline;N-butylbutan-1-amine is sourced from PubChem (CID 69134748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).