About N-propylbutan-1-amine;quinolin-2-amine
N-propylbutan-1-amine;quinolin-2-amine (PubChem CID 143304984) has the molecular formula C16H25N3
and a molecular weight of 259.40 g/mol. Its IUPAC name is N-propylbutan-1-amine;quinolin-2-amine.
Molecular Properties
| Compound Name | N-propylbutan-1-amine;quinolin-2-amine |
| PubChem CID | 143304984 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-propylbutan-1-amine;quinolin-2-amine |
| SMILES | CCCCNCCC.Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C9H8N2.C7H17N/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-3-5-7-8-6-4-2/h1-6H,(H2,10,11);8H,3-7H2,1-2H3 |
| InChIKey | VEEOTYLRHJCNEN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propylbutan-1-amine;quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylbutan-1-amine;quinolin-2-amine?
The IUPAC name of N-propylbutan-1-amine;quinolin-2-amine (CID 143304984) is N-propylbutan-1-amine;quinolin-2-amine.
What is the SMILES notation for N-propylbutan-1-amine;quinolin-2-amine?
The canonical SMILES for N-propylbutan-1-amine;quinolin-2-amine is CCCCNCCC.Nc1ccc2ccccc2n1.
What is the InChIKey of N-propylbutan-1-amine;quinolin-2-amine?
The InChIKey is VEEOTYLRHJCNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C7H17N/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-3-5-7-8-6-4-2/h1-6H,(H2,10,11);8H,3-7H2,1-2H3.
What are the key properties of N-propylbutan-1-amine;quinolin-2-amine?
N-propylbutan-1-amine;quinolin-2-amine has a molecular weight of 259.40 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylbutan-1-amine;quinolin-2-amine is sourced from PubChem (CID 143304984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).