About quinolin-2-amine;sulfuric acid
quinolin-2-amine;sulfuric acid (PubChem CID 159149397) has the molecular formula C9H10N2O4S
and a molecular weight of 242.26 g/mol. Its IUPAC name is quinolin-2-amine;sulfuric acid.
Molecular Properties
| Compound Name | quinolin-2-amine;sulfuric acid |
| PubChem CID | 159149397 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | quinolin-2-amine;sulfuric acid |
| SMILES | Nc1ccc2ccccc2n1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H8N2.H2O4S/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-5(2,3)4/h1-6H,(H2,10,11);(H2,1,2,3,4) |
| InChIKey | KJBWUDZSIATYCJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze quinolin-2-amine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-amine;sulfuric acid?
The IUPAC name of quinolin-2-amine;sulfuric acid (CID 159149397) is quinolin-2-amine;sulfuric acid.
What is the SMILES notation for quinolin-2-amine;sulfuric acid?
The canonical SMILES for quinolin-2-amine;sulfuric acid is Nc1ccc2ccccc2n1.O=S(=O)(O)O.
What is the InChIKey of quinolin-2-amine;sulfuric acid?
The InChIKey is KJBWUDZSIATYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.H2O4S/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-5(2,3)4/h1-6H,(H2,10,11);(H2,1,2,3,4).
What are the key properties of quinolin-2-amine;sulfuric acid?
quinolin-2-amine;sulfuric acid has a molecular weight of 242.26 g/mol, XLogP of 1.16, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-amine;sulfuric acid is sourced from PubChem (CID 159149397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).