About CID 158897445
CID 158897445 (PubChem CID 158897445) has the molecular formula C9H8N2Si
and a molecular weight of 172.26 g/mol.
Molecular Properties
| Compound Name | CID 158897445 |
| PubChem CID | 158897445 |
| Molecular Formula | C9H8N2Si |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | — |
| SMILES | Nc1ccc2ccccc2n1.[Si] |
| InChI | InChI=1S/C9H8N2.Si/c10-9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H2,10,11); |
| InChIKey | JEZWDZPOLXFGFO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158897445 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158897445?
The IUPAC name of CID 158897445 (CID 158897445) is not available.
What is the SMILES notation for CID 158897445?
The canonical SMILES for CID 158897445 is Nc1ccc2ccccc2n1.[Si].
What is the InChIKey of CID 158897445?
The InChIKey is JEZWDZPOLXFGFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.Si/c10-9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H2,10,11);.
What are the key properties of CID 158897445?
CID 158897445 has a molecular weight of 172.26 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158897445 is sourced from PubChem (CID 158897445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).