About silver quinolin-2-olate
silver quinolin-2-olate (PubChem CID 162166701) has the molecular formula C9H6AgNO
and a molecular weight of 252.02 g/mol. Its IUPAC name is silver quinolin-2-olate.
Molecular Properties
| Compound Name | silver quinolin-2-olate |
| PubChem CID | 162166701 |
| Molecular Formula | C9H6AgNO |
| Molecular Weight | 252.02 g/mol |
| Exact Mass | 250.95 |
| IUPAC Name | silver quinolin-2-olate |
| SMILES | [Ag+].[O-]c1ccc2ccccc2n1 |
| InChI | InChI=1S/C9H7NO.Ag/c11-9-6-5-7-3-1-2-4-8(7)10-9;/h1-6H,(H,10,11);/q;+1/p-1 |
| InChIKey | ZNFOZEGMBSHVNE-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.02 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze silver quinolin-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver quinolin-2-olate?
The IUPAC name of silver quinolin-2-olate (CID 162166701) is silver quinolin-2-olate.
What is the SMILES notation for silver quinolin-2-olate?
The canonical SMILES for silver quinolin-2-olate is [Ag+].[O-]c1ccc2ccccc2n1.
What is the InChIKey of silver quinolin-2-olate?
The InChIKey is ZNFOZEGMBSHVNE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NO.Ag/c11-9-6-5-7-3-1-2-4-8(7)10-9;/h1-6H,(H,10,11);/q;+1/p-1.
What are the key properties of silver quinolin-2-olate?
silver quinolin-2-olate has a molecular weight of 252.02 g/mol, XLogP of 1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver quinolin-2-olate is sourced from PubChem (CID 162166701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).