About 2-fluoroquinoline;methane
2-fluoroquinoline;methane (PubChem CID 156751124) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 2-fluoroquinoline;methane.
Molecular Properties
| Compound Name | 2-fluoroquinoline;methane |
| PubChem CID | 156751124 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-fluoroquinoline;methane |
| SMILES | C.Fc1ccc2ccccc2n1 |
| InChI | InChI=1S/C9H6FN.CH4/c10-9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H;1H4 |
| InChIKey | ZADBTLOUSYJCOF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroquinoline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroquinoline;methane?
The IUPAC name of 2-fluoroquinoline;methane (CID 156751124) is 2-fluoroquinoline;methane.
What is the SMILES notation for 2-fluoroquinoline;methane?
The canonical SMILES for 2-fluoroquinoline;methane is C.Fc1ccc2ccccc2n1.
What is the InChIKey of 2-fluoroquinoline;methane?
The InChIKey is ZADBTLOUSYJCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FN.CH4/c10-9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H;1H4.
What are the key properties of 2-fluoroquinoline;methane?
2-fluoroquinoline;methane has a molecular weight of 163.19 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroquinoline;methane is sourced from PubChem (CID 156751124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).