About N,N-dibromoquinolin-2-amine;dihydrate
N,N-dibromoquinolin-2-amine;dihydrate (PubChem CID 174663380) has the molecular formula C9H10Br2N2O2
and a molecular weight of 338.00 g/mol. Its IUPAC name is N,N-dibromoquinolin-2-amine;dihydrate.
Molecular Properties
| Compound Name | N,N-dibromoquinolin-2-amine;dihydrate |
| PubChem CID | 174663380 |
| Molecular Formula | C9H10Br2N2O2 |
| Molecular Weight | 338.00 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | N,N-dibromoquinolin-2-amine;dihydrate |
| SMILES | BrN(Br)c1ccc2ccccc2n1.O.O |
| InChI | InChI=1S/C9H6Br2N2.2H2O/c10-13(11)9-6-5-7-3-1-2-4-8(7)12-9;;/h1-6H;2*1H2 |
| InChIKey | KEZXWTXGTAPZKE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.00 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibromoquinolin-2-amine;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibromoquinolin-2-amine;dihydrate?
The IUPAC name of N,N-dibromoquinolin-2-amine;dihydrate (CID 174663380) is N,N-dibromoquinolin-2-amine;dihydrate.
What is the SMILES notation for N,N-dibromoquinolin-2-amine;dihydrate?
The canonical SMILES for N,N-dibromoquinolin-2-amine;dihydrate is BrN(Br)c1ccc2ccccc2n1.O.O.
What is the InChIKey of N,N-dibromoquinolin-2-amine;dihydrate?
The InChIKey is KEZXWTXGTAPZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Br2N2.2H2O/c10-13(11)9-6-5-7-3-1-2-4-8(7)12-9;;/h1-6H;2*1H2.
What are the key properties of N,N-dibromoquinolin-2-amine;dihydrate?
N,N-dibromoquinolin-2-amine;dihydrate has a molecular weight of 338.00 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibromoquinolin-2-amine;dihydrate is sourced from PubChem (CID 174663380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).