About quinolin-2-yl hypofluorite
quinolin-2-yl hypofluorite (PubChem CID 141219202) has the molecular formula C9H6FNO
and a molecular weight of 163.15 g/mol. Its IUPAC name is quinolin-2-yl hypofluorite.
Molecular Properties
| Compound Name | quinolin-2-yl hypofluorite |
| PubChem CID | 141219202 |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | quinolin-2-yl hypofluorite |
| SMILES | FOc1ccc2ccccc2n1 |
| InChI | InChI=1S/C9H6FNO/c10-12-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| InChIKey | JDFKAHODWWVECQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-2-yl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-yl hypofluorite?
The IUPAC name of quinolin-2-yl hypofluorite (CID 141219202) is quinolin-2-yl hypofluorite.
What is the SMILES notation for quinolin-2-yl hypofluorite?
The canonical SMILES for quinolin-2-yl hypofluorite is FOc1ccc2ccccc2n1.
What is the InChIKey of quinolin-2-yl hypofluorite?
The InChIKey is JDFKAHODWWVECQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO/c10-12-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H.
What are the key properties of quinolin-2-yl hypofluorite?
quinolin-2-yl hypofluorite has a molecular weight of 163.15 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-yl hypofluorite is sourced from PubChem (CID 141219202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).