About 2-tert-butylquinoline;methane
2-tert-butylquinoline;methane (PubChem CID 164995315) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-tert-butylquinoline;methane.
Molecular Properties
| Compound Name | 2-tert-butylquinoline;methane |
| PubChem CID | 164995315 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-tert-butylquinoline;methane |
| SMILES | C.CC(C)(C)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C13H15N.CH4/c1-13(2,3)12-9-8-10-6-4-5-7-11(10)14-12;/h4-9H,1-3H3;1H4 |
| InChIKey | HLXNXABCCHGFDP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butylquinoline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylquinoline;methane?
The IUPAC name of 2-tert-butylquinoline;methane (CID 164995315) is 2-tert-butylquinoline;methane.
What is the SMILES notation for 2-tert-butylquinoline;methane?
The canonical SMILES for 2-tert-butylquinoline;methane is C.CC(C)(C)c1ccc2ccccc2n1.
What is the InChIKey of 2-tert-butylquinoline;methane?
The InChIKey is HLXNXABCCHGFDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N.CH4/c1-13(2,3)12-9-8-10-6-4-5-7-11(10)14-12;/h4-9H,1-3H3;1H4.
What are the key properties of 2-tert-butylquinoline;methane?
2-tert-butylquinoline;methane has a molecular weight of 201.31 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylquinoline;methane is sourced from PubChem (CID 164995315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).