About ethane;methane;2-methylquinoline
ethane;methane;2-methylquinoline (PubChem CID 144748871) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is ethane;methane;2-methylquinoline.
Molecular Properties
| Compound Name | ethane;methane;2-methylquinoline |
| PubChem CID | 144748871 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | ethane;methane;2-methylquinoline |
| SMILES | C.CC.Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H9N.C2H6.CH4/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-2;/h2-7H,1H3;1-2H3;1H4 |
| InChIKey | RZNDYWXMCVZNNN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methane;2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;2-methylquinoline?
The IUPAC name of ethane;methane;2-methylquinoline (CID 144748871) is ethane;methane;2-methylquinoline.
What is the SMILES notation for ethane;methane;2-methylquinoline?
The canonical SMILES for ethane;methane;2-methylquinoline is C.CC.Cc1ccc2ccccc2n1.
What is the InChIKey of ethane;methane;2-methylquinoline?
The InChIKey is RZNDYWXMCVZNNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C2H6.CH4/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-2;/h2-7H,1H3;1-2H3;1H4.
What are the key properties of ethane;methane;2-methylquinoline?
ethane;methane;2-methylquinoline has a molecular weight of 189.30 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;2-methylquinoline is sourced from PubChem (CID 144748871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).