About 2-methylquinoline;pyrimidine
2-methylquinoline;pyrimidine (PubChem CID 174933863) has the molecular formula C14H13N3
and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-methylquinoline;pyrimidine.
Molecular Properties
| Compound Name | 2-methylquinoline;pyrimidine |
| PubChem CID | 174933863 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-methylquinoline;pyrimidine |
| SMILES | Cc1ccc2ccccc2n1.c1cncnc1 |
| InChI | InChI=1S/C10H9N.C4H4N2/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-2-5-4-6-3-1/h2-7H,1H3;1-4H |
| InChIKey | NXRJNGNVNBTQRQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylquinoline;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinoline;pyrimidine?
The IUPAC name of 2-methylquinoline;pyrimidine (CID 174933863) is 2-methylquinoline;pyrimidine.
What is the SMILES notation for 2-methylquinoline;pyrimidine?
The canonical SMILES for 2-methylquinoline;pyrimidine is Cc1ccc2ccccc2n1.c1cncnc1.
What is the InChIKey of 2-methylquinoline;pyrimidine?
The InChIKey is NXRJNGNVNBTQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C4H4N2/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-2-5-4-6-3-1/h2-7H,1H3;1-4H.
What are the key properties of 2-methylquinoline;pyrimidine?
2-methylquinoline;pyrimidine has a molecular weight of 223.28 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinoline;pyrimidine is sourced from PubChem (CID 174933863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).