C14H19NO2 — CID 141397242
butane-1,3-diol;2-methylquinoline (PubChem CID 141397242) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is butane-1,3-diol;2-methylquinoline.
| Compound Name | butane-1,3-diol;2-methylquinoline |
|---|---|
| PubChem CID | 141397242 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | butane-1,3-diol;2-methylquinoline |
| SMILES | CC(O)CCO.Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H9N.C4H10O2/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-4(6)2-3-5/h2-7H,1H3;4-6H,2-3H2,1H3 |
| InChIKey | RGHFSQMLLIAEGZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |