About dihydroxy(oxo)phosphanium;2-methylquinoline
dihydroxy(oxo)phosphanium;2-methylquinoline (PubChem CID 174867800) has the molecular formula C10H11NO3P+
and a molecular weight of 224.18 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-methylquinoline.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;2-methylquinoline |
| PubChem CID | 174867800 |
| Molecular Formula | C10H11NO3P+ |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-methylquinoline |
| SMILES | Cc1ccc2ccccc2n1.O=[P+](O)O |
| InChI | InChI=1S/C10H9N.HO3P/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-4(2)3/h2-7H,1H3;(H-,1,2,3)/p+1 |
| InChIKey | NEVMAFOMRZXJDP-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;2-methylquinoline?
The IUPAC name of dihydroxy(oxo)phosphanium;2-methylquinoline (CID 174867800) is dihydroxy(oxo)phosphanium;2-methylquinoline.
What is the SMILES notation for dihydroxy(oxo)phosphanium;2-methylquinoline?
The canonical SMILES for dihydroxy(oxo)phosphanium;2-methylquinoline is Cc1ccc2ccccc2n1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;2-methylquinoline?
The InChIKey is NEVMAFOMRZXJDP-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H9N.HO3P/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-4(2)3/h2-7H,1H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;2-methylquinoline?
dihydroxy(oxo)phosphanium;2-methylquinoline has a molecular weight of 224.18 g/mol, XLogP of 2.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;2-methylquinoline is sourced from PubChem (CID 174867800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).