About 2-methylquinoline;naphthalene;hydrochloride
2-methylquinoline;naphthalene;hydrochloride (PubChem CID 175029103) has the molecular formula C20H18ClN
and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-methylquinoline;naphthalene;hydrochloride.
Molecular Properties
| Compound Name | 2-methylquinoline;naphthalene;hydrochloride |
| PubChem CID | 175029103 |
| Molecular Formula | C20H18ClN |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-methylquinoline;naphthalene;hydrochloride |
| SMILES | Cc1ccc2ccccc2n1.Cl.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9N.C10H8.ClH/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-2-6-10-8-4-3-7-9(10)5-1;/h2-7H,1H3;1-8H;1H |
| InChIKey | ZMXHBFXHQPGRQI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylquinoline;naphthalene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinoline;naphthalene;hydrochloride?
The IUPAC name of 2-methylquinoline;naphthalene;hydrochloride (CID 175029103) is 2-methylquinoline;naphthalene;hydrochloride.
What is the SMILES notation for 2-methylquinoline;naphthalene;hydrochloride?
The canonical SMILES for 2-methylquinoline;naphthalene;hydrochloride is Cc1ccc2ccccc2n1.Cl.c1ccc2ccccc2c1.
What is the InChIKey of 2-methylquinoline;naphthalene;hydrochloride?
The InChIKey is ZMXHBFXHQPGRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C10H8.ClH/c1-8-6-7-9-4-2-3-5-10(9)11-8;1-2-6-10-8-4-3-7-9(10)5-1;/h2-7H,1H3;1-8H;1H.
What are the key properties of 2-methylquinoline;naphthalene;hydrochloride?
2-methylquinoline;naphthalene;hydrochloride has a molecular weight of 307.82 g/mol, XLogP of 5.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinoline;naphthalene;hydrochloride is sourced from PubChem (CID 175029103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).