About ethane;2-propan-2-ylquinoline
ethane;2-propan-2-ylquinoline (PubChem CID 142538504) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is ethane;2-propan-2-ylquinoline.
Molecular Properties
| Compound Name | ethane;2-propan-2-ylquinoline |
| PubChem CID | 142538504 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | ethane;2-propan-2-ylquinoline |
| SMILES | CC.CC.CC(C)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C12H13N.2C2H6/c1-9(2)11-8-7-10-5-3-4-6-12(10)13-11;2*1-2/h3-9H,1-2H3;2*1-2H3 |
| InChIKey | JJVXNDKSJDPNGM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-propan-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-ylquinoline?
The IUPAC name of ethane;2-propan-2-ylquinoline (CID 142538504) is ethane;2-propan-2-ylquinoline.
What is the SMILES notation for ethane;2-propan-2-ylquinoline?
The canonical SMILES for ethane;2-propan-2-ylquinoline is CC.CC.CC(C)c1ccc2ccccc2n1.
What is the InChIKey of ethane;2-propan-2-ylquinoline?
The InChIKey is JJVXNDKSJDPNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N.2C2H6/c1-9(2)11-8-7-10-5-3-4-6-12(10)13-11;2*1-2/h3-9H,1-2H3;2*1-2H3.
What are the key properties of ethane;2-propan-2-ylquinoline?
ethane;2-propan-2-ylquinoline has a molecular weight of 231.38 g/mol, XLogP of 5.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-ylquinoline is sourced from PubChem (CID 142538504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).