About 2-propan-2-ylquinoline;6-propan-2-ylquinoline
2-propan-2-ylquinoline;6-propan-2-ylquinoline (PubChem CID 67193731) has the molecular formula C24H26N2
and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-propan-2-ylquinoline;6-propan-2-ylquinoline.
Molecular Properties
| Compound Name | 2-propan-2-ylquinoline;6-propan-2-ylquinoline |
| PubChem CID | 67193731 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-propan-2-ylquinoline;6-propan-2-ylquinoline |
| SMILES | CC(C)c1ccc2ccccc2n1.CC(C)c1ccc2ncccc2c1 |
| InChI | InChI=1S/2C12H13N/c1-9(2)10-5-6-12-11(8-10)4-3-7-13-12;1-9(2)11-8-7-10-5-3-4-6-12(10)13-11/h2*3-9H,1-2H3 |
| InChIKey | QZNSUOFUGRAGKG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-ylquinoline;6-propan-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylquinoline;6-propan-2-ylquinoline?
The IUPAC name of 2-propan-2-ylquinoline;6-propan-2-ylquinoline (CID 67193731) is 2-propan-2-ylquinoline;6-propan-2-ylquinoline.
What is the SMILES notation for 2-propan-2-ylquinoline;6-propan-2-ylquinoline?
The canonical SMILES for 2-propan-2-ylquinoline;6-propan-2-ylquinoline is CC(C)c1ccc2ccccc2n1.CC(C)c1ccc2ncccc2c1.
What is the InChIKey of 2-propan-2-ylquinoline;6-propan-2-ylquinoline?
The InChIKey is QZNSUOFUGRAGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H13N/c1-9(2)10-5-6-12-11(8-10)4-3-7-13-12;1-9(2)11-8-7-10-5-3-4-6-12(10)13-11/h2*3-9H,1-2H3.
What are the key properties of 2-propan-2-ylquinoline;6-propan-2-ylquinoline?
2-propan-2-ylquinoline;6-propan-2-ylquinoline has a molecular weight of 342.49 g/mol, XLogP of 6.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylquinoline;6-propan-2-ylquinoline is sourced from PubChem (CID 67193731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).