About 1,1-dichloroethane;quinoline
1,1-dichloroethane;quinoline (PubChem CID 174696538) has the molecular formula C11H11Cl2N
and a molecular weight of 228.12 g/mol. Its IUPAC name is 1,1-dichloroethane;quinoline.
Molecular Properties
| Compound Name | 1,1-dichloroethane;quinoline |
| PubChem CID | 174696538 |
| Molecular Formula | C11H11Cl2N |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 1,1-dichloroethane;quinoline |
| SMILES | CC(Cl)Cl.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H4Cl2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2(3)4/h1-7H;2H,1H3 |
| InChIKey | WKGZQYCUJQMABD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloroethane;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloroethane;quinoline?
The IUPAC name of 1,1-dichloroethane;quinoline (CID 174696538) is 1,1-dichloroethane;quinoline.
What is the SMILES notation for 1,1-dichloroethane;quinoline?
The canonical SMILES for 1,1-dichloroethane;quinoline is CC(Cl)Cl.c1ccc2ncccc2c1.
What is the InChIKey of 1,1-dichloroethane;quinoline?
The InChIKey is WKGZQYCUJQMABD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H4Cl2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2(3)4/h1-7H;2H,1H3.
What are the key properties of 1,1-dichloroethane;quinoline?
1,1-dichloroethane;quinoline has a molecular weight of 228.12 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloroethane;quinoline is sourced from PubChem (CID 174696538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).