About 6-propan-2-ylquinoline;sulfur dioxide
6-propan-2-ylquinoline;sulfur dioxide (PubChem CID 162251791) has the molecular formula C12H13NO2S
and a molecular weight of 235.31 g/mol. Its IUPAC name is 6-propan-2-ylquinoline;sulfur dioxide.
Molecular Properties
| Compound Name | 6-propan-2-ylquinoline;sulfur dioxide |
| PubChem CID | 162251791 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 6-propan-2-ylquinoline;sulfur dioxide |
| SMILES | CC(C)c1ccc2ncccc2c1.O=S=O |
| InChI | InChI=1S/C12H13N.O2S/c1-9(2)10-5-6-12-11(8-10)4-3-7-13-12;1-3-2/h3-9H,1-2H3; |
| InChIKey | ZYBWNGIUHDKUIS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propan-2-ylquinoline;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylquinoline;sulfur dioxide?
The IUPAC name of 6-propan-2-ylquinoline;sulfur dioxide (CID 162251791) is 6-propan-2-ylquinoline;sulfur dioxide.
What is the SMILES notation for 6-propan-2-ylquinoline;sulfur dioxide?
The canonical SMILES for 6-propan-2-ylquinoline;sulfur dioxide is CC(C)c1ccc2ncccc2c1.O=S=O.
What is the InChIKey of 6-propan-2-ylquinoline;sulfur dioxide?
The InChIKey is ZYBWNGIUHDKUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N.O2S/c1-9(2)10-5-6-12-11(8-10)4-3-7-13-12;1-3-2/h3-9H,1-2H3;.
What are the key properties of 6-propan-2-ylquinoline;sulfur dioxide?
6-propan-2-ylquinoline;sulfur dioxide has a molecular weight of 235.31 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylquinoline;sulfur dioxide is sourced from PubChem (CID 162251791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).