About methane;2-propan-2-ylquinoline
methane;2-propan-2-ylquinoline (PubChem CID 161334581) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is methane;2-propan-2-ylquinoline.
Molecular Properties
| Compound Name | methane;2-propan-2-ylquinoline |
| PubChem CID | 161334581 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | methane;2-propan-2-ylquinoline |
| SMILES | C.CC(C)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C12H13N.CH4/c1-9(2)11-8-7-10-5-3-4-6-12(10)13-11;/h3-9H,1-2H3;1H4 |
| InChIKey | VLVYVYXFCSLASM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;2-propan-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-propan-2-ylquinoline?
The IUPAC name of methane;2-propan-2-ylquinoline (CID 161334581) is methane;2-propan-2-ylquinoline.
What is the SMILES notation for methane;2-propan-2-ylquinoline?
The canonical SMILES for methane;2-propan-2-ylquinoline is C.CC(C)c1ccc2ccccc2n1.
What is the InChIKey of methane;2-propan-2-ylquinoline?
The InChIKey is VLVYVYXFCSLASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N.CH4/c1-9(2)11-8-7-10-5-3-4-6-12(10)13-11;/h3-9H,1-2H3;1H4.
What are the key properties of methane;2-propan-2-ylquinoline?
methane;2-propan-2-ylquinoline has a molecular weight of 187.29 g/mol, XLogP of 3.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-propan-2-ylquinoline is sourced from PubChem (CID 161334581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).