About 4-propan-2-ylquinazoline;2-propan-2-ylquinoline
4-propan-2-ylquinazoline;2-propan-2-ylquinoline (PubChem CID 160668104) has the molecular formula C23H25N3
and a molecular weight of 343.47 g/mol. Its IUPAC name is 4-propan-2-ylquinazoline;2-propan-2-ylquinoline.
Molecular Properties
| Compound Name | 4-propan-2-ylquinazoline;2-propan-2-ylquinoline |
| PubChem CID | 160668104 |
| Molecular Formula | C23H25N3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 4-propan-2-ylquinazoline;2-propan-2-ylquinoline |
| SMILES | CC(C)c1ccc2ccccc2n1.CC(C)c1ncnc2ccccc12 |
| InChI | InChI=1S/C12H13N.C11H12N2/c1-9(2)11-8-7-10-5-3-4-6-12(10)13-11;1-8(2)11-9-5-3-4-6-10(9)12-7-13-11/h3-9H,1-2H3;3-8H,1-2H3 |
| InChIKey | RMOPOMSMALQTGA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-ylquinazoline;2-propan-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylquinazoline;2-propan-2-ylquinoline?
The IUPAC name of 4-propan-2-ylquinazoline;2-propan-2-ylquinoline (CID 160668104) is 4-propan-2-ylquinazoline;2-propan-2-ylquinoline.
What is the SMILES notation for 4-propan-2-ylquinazoline;2-propan-2-ylquinoline?
The canonical SMILES for 4-propan-2-ylquinazoline;2-propan-2-ylquinoline is CC(C)c1ccc2ccccc2n1.CC(C)c1ncnc2ccccc12.
What is the InChIKey of 4-propan-2-ylquinazoline;2-propan-2-ylquinoline?
The InChIKey is RMOPOMSMALQTGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N.C11H12N2/c1-9(2)11-8-7-10-5-3-4-6-12(10)13-11;1-8(2)11-9-5-3-4-6-10(9)12-7-13-11/h3-9H,1-2H3;3-8H,1-2H3.
What are the key properties of 4-propan-2-ylquinazoline;2-propan-2-ylquinoline?
4-propan-2-ylquinazoline;2-propan-2-ylquinoline has a molecular weight of 343.47 g/mol, XLogP of 6.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylquinazoline;2-propan-2-ylquinoline is sourced from PubChem (CID 160668104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).