About 2-methylquinoline;quinoline-2-carboxamide
2-methylquinoline;quinoline-2-carboxamide (PubChem CID 174829911) has the molecular formula C20H17N3O
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-methylquinoline;quinoline-2-carboxamide.
Molecular Properties
| Compound Name | 2-methylquinoline;quinoline-2-carboxamide |
| PubChem CID | 174829911 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-methylquinoline;quinoline-2-carboxamide |
| SMILES | Cc1ccc2ccccc2n1.NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H8N2O.C10H9N/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9;1-8-6-7-9-4-2-3-5-10(9)11-8/h1-6H,(H2,11,13);2-7H,1H3 |
| InChIKey | BNPFFWVAASQNNH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylquinoline;quinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinoline;quinoline-2-carboxamide?
The IUPAC name of 2-methylquinoline;quinoline-2-carboxamide (CID 174829911) is 2-methylquinoline;quinoline-2-carboxamide.
What is the SMILES notation for 2-methylquinoline;quinoline-2-carboxamide?
The canonical SMILES for 2-methylquinoline;quinoline-2-carboxamide is Cc1ccc2ccccc2n1.NC(=O)c1ccc2ccccc2n1.
What is the InChIKey of 2-methylquinoline;quinoline-2-carboxamide?
The InChIKey is BNPFFWVAASQNNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O.C10H9N/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9;1-8-6-7-9-4-2-3-5-10(9)11-8/h1-6H,(H2,11,13);2-7H,1H3.
What are the key properties of 2-methylquinoline;quinoline-2-carboxamide?
2-methylquinoline;quinoline-2-carboxamide has a molecular weight of 315.38 g/mol, XLogP of 3.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinoline;quinoline-2-carboxamide is sourced from PubChem (CID 174829911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).