About copper(1+);quinoline-2-carboxylate
copper(1+);quinoline-2-carboxylate (PubChem CID 159046158) has the molecular formula C10H6CuNO2
and a molecular weight of 235.71 g/mol. Its IUPAC name is copper(1+);quinoline-2-carboxylate.
Molecular Properties
| Compound Name | copper(1+);quinoline-2-carboxylate |
| PubChem CID | 159046158 |
| Molecular Formula | C10H6CuNO2 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | copper(1+);quinoline-2-carboxylate |
| SMILES | O=C([O-])c1ccc2ccccc2n1.[Cu+] |
| InChI | InChI=1S/C10H7NO2.Cu/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);/q;+1/p-1 |
| InChIKey | JWRJJCZFGOETPF-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze copper(1+);quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);quinoline-2-carboxylate?
The IUPAC name of copper(1+);quinoline-2-carboxylate (CID 159046158) is copper(1+);quinoline-2-carboxylate.
What is the SMILES notation for copper(1+);quinoline-2-carboxylate?
The canonical SMILES for copper(1+);quinoline-2-carboxylate is O=C([O-])c1ccc2ccccc2n1.[Cu+].
What is the InChIKey of copper(1+);quinoline-2-carboxylate?
The InChIKey is JWRJJCZFGOETPF-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H7NO2.Cu/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);/q;+1/p-1.
What are the key properties of copper(1+);quinoline-2-carboxylate?
copper(1+);quinoline-2-carboxylate has a molecular weight of 235.71 g/mol, XLogP of 0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);quinoline-2-carboxylate is sourced from PubChem (CID 159046158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).