About potassium;hydride;quinoline-2-carboxylic acid
potassium;hydride;quinoline-2-carboxylic acid (PubChem CID 174828478) has the molecular formula C10H8KNO2
and a molecular weight of 213.28 g/mol. Its IUPAC name is potassium;hydride;quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | potassium;hydride;quinoline-2-carboxylic acid |
| PubChem CID | 174828478 |
| Molecular Formula | C10H8KNO2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | potassium;hydride;quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccccc2n1.[H-].[K+] |
| InChI | InChI=1S/C10H7NO2.K.H/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;;/h1-6H,(H,12,13);;/q;+1;-1 |
| InChIKey | PIEXNMNWQCQLNM-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;hydride;quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;quinoline-2-carboxylic acid?
The IUPAC name of potassium;hydride;quinoline-2-carboxylic acid (CID 174828478) is potassium;hydride;quinoline-2-carboxylic acid.
What is the SMILES notation for potassium;hydride;quinoline-2-carboxylic acid?
The canonical SMILES for potassium;hydride;quinoline-2-carboxylic acid is O=C(O)c1ccc2ccccc2n1.[H-].[K+].
What is the InChIKey of potassium;hydride;quinoline-2-carboxylic acid?
The InChIKey is PIEXNMNWQCQLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.K.H/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;;/h1-6H,(H,12,13);;/q;+1;-1.
What are the key properties of potassium;hydride;quinoline-2-carboxylic acid?
potassium;hydride;quinoline-2-carboxylic acid has a molecular weight of 213.28 g/mol, XLogP of -0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;quinoline-2-carboxylic acid is sourced from PubChem (CID 174828478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).