copper;quinoline-2-carboxylic acid

C10H7CuNO2 — CID 68537473

IUPACcopper;quinoline-2-carboxylic acid
SMILESO=C(O)c1ccc2ccccc2n1.[Cu]
InChIInChI=1S/C10H7NO2.Cu/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);
InChIKeyHKGFOEUKNCRDRV-UHFFFAOYSA-N
MW236.72 g/mol
LogP1.93
Rot. Bonds1

About copper;quinoline-2-carboxylic acid

copper;quinoline-2-carboxylic acid (PubChem CID 68537473) has the molecular formula C10H7CuNO2 and a molecular weight of 236.72 g/mol. Its IUPAC name is copper;quinoline-2-carboxylic acid.

Molecular Properties

Compound Namecopper;quinoline-2-carboxylic acid
PubChem CID68537473
Molecular FormulaC10H7CuNO2
Molecular Weight236.72 g/mol
Exact Mass235.98
IUPAC Namecopper;quinoline-2-carboxylic acid
SMILESO=C(O)c1ccc2ccccc2n1.[Cu]
InChIInChI=1S/C10H7NO2.Cu/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);
InChIKeyHKGFOEUKNCRDRV-UHFFFAOYSA-N
XLogP1.93
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.72
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze copper;quinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of copper;quinoline-2-carboxylic acid?
The IUPAC name of copper;quinoline-2-carboxylic acid (CID 68537473) is copper;quinoline-2-carboxylic acid.
What is the SMILES notation for copper;quinoline-2-carboxylic acid?
The canonical SMILES for copper;quinoline-2-carboxylic acid is O=C(O)c1ccc2ccccc2n1.[Cu].
What is the InChIKey of copper;quinoline-2-carboxylic acid?
The InChIKey is HKGFOEUKNCRDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.Cu/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);.
What are the key properties of copper;quinoline-2-carboxylic acid?
copper;quinoline-2-carboxylic acid has a molecular weight of 236.72 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;quinoline-2-carboxylic acid is sourced from PubChem (CID 68537473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).