About copper;quinoline-2-carboxylic acid
copper;quinoline-2-carboxylic acid (PubChem CID 68537473) has the molecular formula C10H7CuNO2
and a molecular weight of 236.72 g/mol. Its IUPAC name is copper;quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | copper;quinoline-2-carboxylic acid |
| PubChem CID | 68537473 |
| Molecular Formula | C10H7CuNO2 |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | copper;quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccccc2n1.[Cu] |
| InChI | InChI=1S/C10H7NO2.Cu/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13); |
| InChIKey | HKGFOEUKNCRDRV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;quinoline-2-carboxylic acid?
The IUPAC name of copper;quinoline-2-carboxylic acid (CID 68537473) is copper;quinoline-2-carboxylic acid.
What is the SMILES notation for copper;quinoline-2-carboxylic acid?
The canonical SMILES for copper;quinoline-2-carboxylic acid is O=C(O)c1ccc2ccccc2n1.[Cu].
What is the InChIKey of copper;quinoline-2-carboxylic acid?
The InChIKey is HKGFOEUKNCRDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.Cu/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H,12,13);.
What are the key properties of copper;quinoline-2-carboxylic acid?
copper;quinoline-2-carboxylic acid has a molecular weight of 236.72 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;quinoline-2-carboxylic acid is sourced from PubChem (CID 68537473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).