About acetic acid;1H-indole;quinoline-2-carboxylic acid
acetic acid;1H-indole;quinoline-2-carboxylic acid (PubChem CID 175370124) has the molecular formula C20H18N2O4
and a molecular weight of 350.37 g/mol. Its IUPAC name is acetic acid;1H-indole;quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | acetic acid;1H-indole;quinoline-2-carboxylic acid |
| PubChem CID | 175370124 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | acetic acid;1H-indole;quinoline-2-carboxylic acid |
| SMILES | CC(=O)O.O=C(O)c1ccc2ccccc2n1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H7NO2.C8H7N.C2H4O2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;1-2-4-8-7(3-1)5-6-9-8;1-2(3)4/h1-6H,(H,12,13);1-6,9H;1H3,(H,3,4) |
| InChIKey | NSCJNNPHSCXWDC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;1H-indole;quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1H-indole;quinoline-2-carboxylic acid?
The IUPAC name of acetic acid;1H-indole;quinoline-2-carboxylic acid (CID 175370124) is acetic acid;1H-indole;quinoline-2-carboxylic acid.
What is the SMILES notation for acetic acid;1H-indole;quinoline-2-carboxylic acid?
The canonical SMILES for acetic acid;1H-indole;quinoline-2-carboxylic acid is CC(=O)O.O=C(O)c1ccc2ccccc2n1.c1ccc2[nH]ccc2c1.
What is the InChIKey of acetic acid;1H-indole;quinoline-2-carboxylic acid?
The InChIKey is NSCJNNPHSCXWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.C8H7N.C2H4O2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;1-2-4-8-7(3-1)5-6-9-8;1-2(3)4/h1-6H,(H,12,13);1-6,9H;1H3,(H,3,4).
What are the key properties of acetic acid;1H-indole;quinoline-2-carboxylic acid?
acetic acid;1H-indole;quinoline-2-carboxylic acid has a molecular weight of 350.37 g/mol, XLogP of 4.19, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1H-indole;quinoline-2-carboxylic acid is sourced from PubChem (CID 175370124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).