About hydroxyurea;1H-indole
hydroxyurea;1H-indole (PubChem CID 19379049) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is hydroxyurea;1H-indole.
Molecular Properties
| Compound Name | hydroxyurea;1H-indole |
| PubChem CID | 19379049 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | hydroxyurea;1H-indole |
| SMILES | NC(=O)NO.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.CH4N2O2/c1-2-4-8-7(3-1)5-6-9-8;2-1(4)3-5/h1-6,9H;5H,(H3,2,3,4) |
| InChIKey | DFIWPZCPDJDKLF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxyurea;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxyurea;1H-indole?
The IUPAC name of hydroxyurea;1H-indole (CID 19379049) is hydroxyurea;1H-indole.
What is the SMILES notation for hydroxyurea;1H-indole?
The canonical SMILES for hydroxyurea;1H-indole is NC(=O)NO.c1ccc2[nH]ccc2c1.
What is the InChIKey of hydroxyurea;1H-indole?
The InChIKey is DFIWPZCPDJDKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.CH4N2O2/c1-2-4-8-7(3-1)5-6-9-8;2-1(4)3-5/h1-6,9H;5H,(H3,2,3,4).
What are the key properties of hydroxyurea;1H-indole?
hydroxyurea;1H-indole has a molecular weight of 193.21 g/mol, XLogP of 1.21, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxyurea;1H-indole is sourced from PubChem (CID 19379049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).