About 1H-indole;oxozinc
1H-indole;oxozinc (PubChem CID 174920230) has the molecular formula C8H7NOZn
and a molecular weight of 198.54 g/mol. Its IUPAC name is 1H-indole;oxozinc.
Molecular Properties
| Compound Name | 1H-indole;oxozinc |
| PubChem CID | 174920230 |
| Molecular Formula | C8H7NOZn |
| Molecular Weight | 198.54 g/mol |
| Exact Mass | 196.98 |
| IUPAC Name | 1H-indole;oxozinc |
| SMILES | O=[Zn].c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.O.Zn/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6,9H;; |
| InChIKey | PYFITYRCDQGPRR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole;oxozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;oxozinc?
The IUPAC name of 1H-indole;oxozinc (CID 174920230) is 1H-indole;oxozinc.
What is the SMILES notation for 1H-indole;oxozinc?
The canonical SMILES for 1H-indole;oxozinc is O=[Zn].c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;oxozinc?
The InChIKey is PYFITYRCDQGPRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.O.Zn/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6,9H;;.
What are the key properties of 1H-indole;oxozinc?
1H-indole;oxozinc has a molecular weight of 198.54 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;oxozinc is sourced from PubChem (CID 174920230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).