About carbamic acid;1H-indole
carbamic acid;1H-indole (PubChem CID 66672708) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is carbamic acid;1H-indole.
Molecular Properties
| Compound Name | carbamic acid;1H-indole |
| PubChem CID | 66672708 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | carbamic acid;1H-indole |
| SMILES | NC(=O)O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.CH3NO2/c1-2-4-8-7(3-1)5-6-9-8;2-1(3)4/h1-6,9H;2H2,(H,3,4) |
| InChIKey | DLZFBCKCPJBHKS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbamic acid;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;1H-indole?
The IUPAC name of carbamic acid;1H-indole (CID 66672708) is carbamic acid;1H-indole.
What is the SMILES notation for carbamic acid;1H-indole?
The canonical SMILES for carbamic acid;1H-indole is NC(=O)O.c1ccc2[nH]ccc2c1.
What is the InChIKey of carbamic acid;1H-indole?
The InChIKey is DLZFBCKCPJBHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.CH3NO2/c1-2-4-8-7(3-1)5-6-9-8;2-1(3)4/h1-6,9H;2H2,(H,3,4).
What are the key properties of carbamic acid;1H-indole?
carbamic acid;1H-indole has a molecular weight of 178.19 g/mol, XLogP of 1.79, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;1H-indole is sourced from PubChem (CID 66672708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).