About cesium;1H-indole;hydroxide
cesium;1H-indole;hydroxide (PubChem CID 175329356) has the molecular formula C8H8CsNO
and a molecular weight of 267.06 g/mol. Its IUPAC name is cesium;1H-indole;hydroxide.
Molecular Properties
| Compound Name | cesium;1H-indole;hydroxide |
| PubChem CID | 175329356 |
| Molecular Formula | C8H8CsNO |
| Molecular Weight | 267.06 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | cesium;1H-indole;hydroxide |
| SMILES | [Cs+].[OH-].c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.Cs.H2O/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6,9H;;1H2/q;+1;/p-1 |
| InChIKey | NWYXHHLDNNXVLM-UHFFFAOYSA-M |
| XLogP | -1.00 |
| TPSA | 45.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.06 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cesium;1H-indole;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;1H-indole;hydroxide?
The IUPAC name of cesium;1H-indole;hydroxide (CID 175329356) is cesium;1H-indole;hydroxide.
What is the SMILES notation for cesium;1H-indole;hydroxide?
The canonical SMILES for cesium;1H-indole;hydroxide is [Cs+].[OH-].c1ccc2[nH]ccc2c1.
What is the InChIKey of cesium;1H-indole;hydroxide?
The InChIKey is NWYXHHLDNNXVLM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7N.Cs.H2O/c1-2-4-8-7(3-1)5-6-9-8;;/h1-6,9H;;1H2/q;+1;/p-1.
What are the key properties of cesium;1H-indole;hydroxide?
cesium;1H-indole;hydroxide has a molecular weight of 267.06 g/mol, XLogP of -1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;1H-indole;hydroxide is sourced from PubChem (CID 175329356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).