About 1H-indole;propan-2-amine
1H-indole;propan-2-amine (PubChem CID 172785583) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1H-indole;propan-2-amine.
Molecular Properties
| Compound Name | 1H-indole;propan-2-amine |
| PubChem CID | 172785583 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1H-indole;propan-2-amine |
| SMILES | CC(C)N.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C3H9N/c1-2-4-8-7(3-1)5-6-9-8;1-3(2)4/h1-6,9H;3H,4H2,1-2H3 |
| InChIKey | OVRPGRCJTAPVJQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;propan-2-amine?
The IUPAC name of 1H-indole;propan-2-amine (CID 172785583) is 1H-indole;propan-2-amine.
What is the SMILES notation for 1H-indole;propan-2-amine?
The canonical SMILES for 1H-indole;propan-2-amine is CC(C)N.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;propan-2-amine?
The InChIKey is OVRPGRCJTAPVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C3H9N/c1-2-4-8-7(3-1)5-6-9-8;1-3(2)4/h1-6,9H;3H,4H2,1-2H3.
What are the key properties of 1H-indole;propan-2-amine?
1H-indole;propan-2-amine has a molecular weight of 176.26 g/mol, XLogP of 2.52, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;propan-2-amine is sourced from PubChem (CID 172785583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).