C14H22N4 — CID 158488040
1H-indole;1,4,7-triazonane (PubChem CID 158488040) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1H-indole;1,4,7-triazonane.
| Compound Name | 1H-indole;1,4,7-triazonane |
|---|---|
| PubChem CID | 158488040 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1H-indole;1,4,7-triazonane |
| SMILES | C1CNCCNCCN1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C6H15N3/c1-2-4-8-7(3-1)5-6-9-8;1-2-8-5-6-9-4-3-7-1/h1-6,9H;7-9H,1-6H2 |
| InChIKey | HIIQBASGFBSFSK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 51.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |