About CID 175434437
CID 175434437 (PubChem CID 175434437) has the molecular formula C8H10B3N4
and a molecular weight of 194.63 g/mol.
Molecular Properties
| Compound Name | CID 175434437 |
| PubChem CID | 175434437 |
| Molecular Formula | C8H10B3N4 |
| Molecular Weight | 194.63 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | — |
| SMILES | [B]1N[B]N[B]N1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.B3H3N3/c1-2-4-8-7(3-1)5-6-9-8;1-4-2-6-3-5-1/h1-6,9H;4-6H |
| InChIKey | RFGLWHPFOFEXIZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 51.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.63 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175434437 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175434437?
The IUPAC name of CID 175434437 (CID 175434437) is not available.
What is the SMILES notation for CID 175434437?
The canonical SMILES for CID 175434437 is [B]1N[B]N[B]N1.c1ccc2[nH]ccc2c1.
What is the InChIKey of CID 175434437?
The InChIKey is RFGLWHPFOFEXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.B3H3N3/c1-2-4-8-7(3-1)5-6-9-8;1-4-2-6-3-5-1/h1-6,9H;4-6H.
What are the key properties of CID 175434437?
CID 175434437 has a molecular weight of 194.63 g/mol, XLogP of -0.46, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175434437 is sourced from PubChem (CID 175434437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).