About acetic acid;bis(1H-indole)
acetic acid;bis(1H-indole) (PubChem CID 162014067) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is acetic acid;bis(1H-indole).
Molecular Properties
| Compound Name | acetic acid;bis(1H-indole) |
| PubChem CID | 162014067 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | acetic acid;bis(1H-indole) |
| SMILES | CC(=O)O.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/2C8H7N.C2H4O2/c2*1-2-4-8-7(3-1)5-6-9-8;1-2(3)4/h2*1-6,9H;1H3,(H,3,4) |
| InChIKey | YTWDDRXDGCIGAI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;bis(1H-indole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;bis(1H-indole)?
The IUPAC name of acetic acid;bis(1H-indole) (CID 162014067) is acetic acid;bis(1H-indole).
What is the SMILES notation for acetic acid;bis(1H-indole)?
The canonical SMILES for acetic acid;bis(1H-indole) is CC(=O)O.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.
What is the InChIKey of acetic acid;bis(1H-indole)?
The InChIKey is YTWDDRXDGCIGAI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7N.C2H4O2/c2*1-2-4-8-7(3-1)5-6-9-8;1-2(3)4/h2*1-6,9H;1H3,(H,3,4).
What are the key properties of acetic acid;bis(1H-indole)?
acetic acid;bis(1H-indole) has a molecular weight of 294.35 g/mol, XLogP of 4.43, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;bis(1H-indole) is sourced from PubChem (CID 162014067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).