acetic acid;bis(1H-indole)

C18H18N2O2 — CID 162014067

IUPACacetic acid;bis(1H-indole)
SMILESCC(=O)O.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1
InChIInChI=1S/2C8H7N.C2H4O2/c2*1-2-4-8-7(3-1)5-6-9-8;1-2(3)4/h2*1-6,9H;1H3,(H,3,4)
InChIKeyYTWDDRXDGCIGAI-UHFFFAOYSA-N
MW294.35 g/mol
LogP4.43
Rot. Bonds

About acetic acid;bis(1H-indole)

acetic acid;bis(1H-indole) (PubChem CID 162014067) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is acetic acid;bis(1H-indole).

Molecular Properties

Compound Nameacetic acid;bis(1H-indole)
PubChem CID162014067
Molecular FormulaC18H18N2O2
Molecular Weight294.35 g/mol
Exact Mass294.14
IUPAC Nameacetic acid;bis(1H-indole)
SMILESCC(=O)O.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1
InChIInChI=1S/2C8H7N.C2H4O2/c2*1-2-4-8-7(3-1)5-6-9-8;1-2(3)4/h2*1-6,9H;1H3,(H,3,4)
InChIKeyYTWDDRXDGCIGAI-UHFFFAOYSA-N
XLogP4.43
TPSA68.88 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.35
LogP ≤ 54.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Analyze acetic acid;bis(1H-indole) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;bis(1H-indole)?
The IUPAC name of acetic acid;bis(1H-indole) (CID 162014067) is acetic acid;bis(1H-indole).
What is the SMILES notation for acetic acid;bis(1H-indole)?
The canonical SMILES for acetic acid;bis(1H-indole) is CC(=O)O.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.
What is the InChIKey of acetic acid;bis(1H-indole)?
The InChIKey is YTWDDRXDGCIGAI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7N.C2H4O2/c2*1-2-4-8-7(3-1)5-6-9-8;1-2(3)4/h2*1-6,9H;1H3,(H,3,4).
What are the key properties of acetic acid;bis(1H-indole)?
acetic acid;bis(1H-indole) has a molecular weight of 294.35 g/mol, XLogP of 4.43, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;bis(1H-indole) is sourced from PubChem (CID 162014067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).