About 1H-indole;2-oxopropanoyl chloride
1H-indole;2-oxopropanoyl chloride (PubChem CID 143293579) has the molecular formula C11H10ClNO2
and a molecular weight of 223.66 g/mol. Its IUPAC name is 1H-indole;2-oxopropanoyl chloride.
Molecular Properties
| Compound Name | 1H-indole;2-oxopropanoyl chloride |
| PubChem CID | 143293579 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 1H-indole;2-oxopropanoyl chloride |
| SMILES | CC(=O)C(=O)Cl.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C3H3ClO2/c1-2-4-8-7(3-1)5-6-9-8;1-2(5)3(4)6/h1-6,9H;1H3 |
| InChIKey | LOVURKRVZGOMMD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole;2-oxopropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;2-oxopropanoyl chloride?
The IUPAC name of 1H-indole;2-oxopropanoyl chloride (CID 143293579) is 1H-indole;2-oxopropanoyl chloride.
What is the SMILES notation for 1H-indole;2-oxopropanoyl chloride?
The canonical SMILES for 1H-indole;2-oxopropanoyl chloride is CC(=O)C(=O)Cl.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;2-oxopropanoyl chloride?
The InChIKey is LOVURKRVZGOMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C3H3ClO2/c1-2-4-8-7(3-1)5-6-9-8;1-2(5)3(4)6/h1-6,9H;1H3.
What are the key properties of 1H-indole;2-oxopropanoyl chloride?
1H-indole;2-oxopropanoyl chloride has a molecular weight of 223.66 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;2-oxopropanoyl chloride is sourced from PubChem (CID 143293579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).