About 1H-indole;oxalyl dichloride
1H-indole;oxalyl dichloride (PubChem CID 87707386) has the molecular formula C10H7Cl2NO2
and a molecular weight of 244.08 g/mol. Its IUPAC name is 1H-indole;oxalyl dichloride.
Molecular Properties
| Compound Name | 1H-indole;oxalyl dichloride |
| PubChem CID | 87707386 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 1H-indole;oxalyl dichloride |
| SMILES | O=C(Cl)C(=O)Cl.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C2Cl2O2/c1-2-4-8-7(3-1)5-6-9-8;3-1(5)2(4)6/h1-6,9H; |
| InChIKey | SNQXBENVBDLMJM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole;oxalyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;oxalyl dichloride?
The IUPAC name of 1H-indole;oxalyl dichloride (CID 87707386) is 1H-indole;oxalyl dichloride.
What is the SMILES notation for 1H-indole;oxalyl dichloride?
The canonical SMILES for 1H-indole;oxalyl dichloride is O=C(Cl)C(=O)Cl.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;oxalyl dichloride?
The InChIKey is SNQXBENVBDLMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C2Cl2O2/c1-2-4-8-7(3-1)5-6-9-8;3-1(5)2(4)6/h1-6,9H;.
What are the key properties of 1H-indole;oxalyl dichloride?
1H-indole;oxalyl dichloride has a molecular weight of 244.08 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;oxalyl dichloride is sourced from PubChem (CID 87707386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).