About quinoline-2-carboxamide;hydrobromide
quinoline-2-carboxamide;hydrobromide (PubChem CID 141009871) has the molecular formula C10H9BrN2O
and a molecular weight of 253.10 g/mol. Its IUPAC name is quinoline-2-carboxamide;hydrobromide.
Molecular Properties
| Compound Name | quinoline-2-carboxamide;hydrobromide |
| PubChem CID | 141009871 |
| Molecular Formula | C10H9BrN2O |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | quinoline-2-carboxamide;hydrobromide |
| SMILES | Br.NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H8N2O.BrH/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9;/h1-6H,(H2,11,13);1H |
| InChIKey | KMICVSFBPZVPFR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinoline-2-carboxamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-2-carboxamide;hydrobromide?
The IUPAC name of quinoline-2-carboxamide;hydrobromide (CID 141009871) is quinoline-2-carboxamide;hydrobromide.
What is the SMILES notation for quinoline-2-carboxamide;hydrobromide?
The canonical SMILES for quinoline-2-carboxamide;hydrobromide is Br.NC(=O)c1ccc2ccccc2n1.
What is the InChIKey of quinoline-2-carboxamide;hydrobromide?
The InChIKey is KMICVSFBPZVPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O.BrH/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9;/h1-6H,(H2,11,13);1H.
What are the key properties of quinoline-2-carboxamide;hydrobromide?
quinoline-2-carboxamide;hydrobromide has a molecular weight of 253.10 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-2-carboxamide;hydrobromide is sourced from PubChem (CID 141009871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).