About quinoline-2-carboxamide;quinoxaline
quinoline-2-carboxamide;quinoxaline (PubChem CID 159476975) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is quinoline-2-carboxamide;quinoxaline.
Molecular Properties
| Compound Name | quinoline-2-carboxamide;quinoxaline |
| PubChem CID | 159476975 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | quinoline-2-carboxamide;quinoxaline |
| SMILES | NC(=O)c1ccc2ccccc2n1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C10H8N2O.C8H6N2/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9;1-2-4-8-7(3-1)9-5-6-10-8/h1-6H,(H2,11,13);1-6H |
| InChIKey | LWMRTEUYQLXWQO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze quinoline-2-carboxamide;quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-2-carboxamide;quinoxaline?
The IUPAC name of quinoline-2-carboxamide;quinoxaline (CID 159476975) is quinoline-2-carboxamide;quinoxaline.
What is the SMILES notation for quinoline-2-carboxamide;quinoxaline?
The canonical SMILES for quinoline-2-carboxamide;quinoxaline is NC(=O)c1ccc2ccccc2n1.c1ccc2nccnc2c1.
What is the InChIKey of quinoline-2-carboxamide;quinoxaline?
The InChIKey is LWMRTEUYQLXWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O.C8H6N2/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9;1-2-4-8-7(3-1)9-5-6-10-8/h1-6H,(H2,11,13);1-6H.
What are the key properties of quinoline-2-carboxamide;quinoxaline?
quinoline-2-carboxamide;quinoxaline has a molecular weight of 302.34 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-2-carboxamide;quinoxaline is sourced from PubChem (CID 159476975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).