About (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate)
(2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) (PubChem CID 161019161) has the molecular formula C32H21AlN2O5
and a molecular weight of 540.51 g/mol. Its IUPAC name is (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate).
Molecular Properties
| Compound Name | (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) |
| PubChem CID | 161019161 |
| Molecular Formula | C32H21AlN2O5 |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) |
| SMILES | O=C([O-])c1ccc2ccccc2n1.O=C([O-])c1ccc2ccccc2n1.[Al+2]Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.2C10H7NO2.Al/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2*12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-9,13H;2*1-6H,(H,12,13);/q;;;+3/p-3 |
| InChIKey | TYDBDEXVEJRPKH-UHFFFAOYSA-K |
| XLogP | 4.01 |
| TPSA | 115.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate)?
The IUPAC name of (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) (CID 161019161) is (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate).
What is the SMILES notation for (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate)?
The canonical SMILES for (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) is O=C([O-])c1ccc2ccccc2n1.O=C([O-])c1ccc2ccccc2n1.[Al+2]Oc1ccccc1-c1ccccc1.
What is the InChIKey of (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate)?
The InChIKey is TYDBDEXVEJRPKH-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H10O.2C10H7NO2.Al/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2*12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-9,13H;2*1-6H,(H,12,13);/q;;;+3/p-3.
What are the key properties of (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate)?
(2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) has a molecular weight of 540.51 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenoxy)aluminum(2+);bis(quinoline-2-carboxylate) is sourced from PubChem (CID 161019161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).