C25H20N2O3 — CID 7812711
[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] quinoline-2-carboxylate (PubChem CID 7812711) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] quinoline-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7812711 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] quinoline-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H20N2O3/c1-17(30-25(29)23-16-15-19-11-5-7-13-21(19)26-23)24(28)27-22-14-8-6-12-20(22)18-9-3-2-4-10-18/h2-17H,1H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | SFDJFMSQBFUOSQ-KRWDZBQOSA-N |
| XLogP | 5.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |