C27H18N2O5 — CID 41293332
[(2R)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] quinoline-2-carboxylate (PubChem CID 41293332) has the molecular formula C27H18N2O5 and a molecular weight of 450.45 g/mol. Its IUPAC name is [(2R)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] quinoline-2-carboxylate.
| Compound Name | [(2R)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 41293332 |
| Molecular Formula | C27H18N2O5 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [(2R)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] quinoline-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc2ccccc2n1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H18N2O5/c1-15(34-27(33)22-14-13-16-7-2-5-11-20(16)28-22)26(32)29-21-12-6-10-19-23(21)25(31)18-9-4-3-8-17(18)24(19)30/h2-15H,1H3,(H,29,32)/t15-/m1/s1 |
| InChIKey | ARMCJIGQWOZYFB-OAHLLOKOSA-N |
| XLogP | 4.19 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|