C27H23NO6 — CID 41293384
[(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate (PubChem CID 41293384) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is [(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate.
| Compound Name | [(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 41293384 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [(2S)-1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)O[C@@H](C)C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C27H23NO6/c1-15(2)33-18-13-11-17(12-14-18)27(32)34-16(3)26(31)28-22-10-6-9-21-23(22)25(30)20-8-5-4-7-19(20)24(21)29/h4-16H,1-3H3,(H,28,31)/t16-/m0/s1 |
| InChIKey | TUGUWQJQSBLIEG-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|