C25H20N2O7S — CID 55568043
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-methyl-3-sulfamoylbenzoate (PubChem CID 55568043) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-methyl-3-sulfamoylbenzoate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-methyl-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55568043 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-methyl-3-sulfamoylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C25H20N2O7S/c1-13-10-11-15(12-20(13)35(26,32)33)25(31)34-14(2)24(30)27-19-9-5-8-18-21(19)23(29)17-7-4-3-6-16(17)22(18)28/h3-12,14H,1-2H3,(H,27,30)(H2,26,32,33) |
| InChIKey | KLJHIFSSDZHCCN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|