C22H16N2O8S — CID 55643882
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643882) has the molecular formula C22H16N2O8S and a molecular weight of 468.44 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643882 |
| Molecular Formula | C22H16N2O8S |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(S(N)(=O)=O)o1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H16N2O8S/c1-11(31-22(28)16-9-10-17(32-16)33(23,29)30)21(27)24-15-8-4-7-14-18(15)20(26)13-6-3-2-5-12(13)19(14)25/h2-11H,1H3,(H,24,27)(H2,23,29,30) |
| InChIKey | XSZSRMLYGJMLGH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|